dioctyl hexanedioate


DOA; dioctyl adipate; dioctyl hexanedioate
Links:🕷 ChemSpider, 📖 PubMed
CAS RN:[123-79-5]
Formula:C22H42O4; 370.57 g/mol
InChiKey:NEHDRDVHPTWWFG-UHFFFAOYSA-N
SMILES:CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC
Molecular structure of dioctyl hexanedioate
Density:0.980 g/mL
Molar volume:378.1 mL/mol
Melting point:-70 °C
Boiling point:405 °C
Hansen solubility parameter:δd: 1.0 (cal/ml)^0.5   δp: 2.0 (cal/ml)^0.5  

Isomers

diethyl octadecanedioate
Molecular structure of diethyl octadecanedioate
dihexyl decanedioate
Molecular structure of dihexyl decanedioate
dioctyl hexanedioate
Molecular structure of dioctyl hexanedioate
2-ethoxyethyl (Z,12R)-12-hydroxyoctadec-9-enoate
Molecular structure of 2-ethoxyethyl (Z,12R)-12-hydroxyoctadec-9-enoate